C21H22F2N4OS — CID 29201094
1-(4-benzylpiperazin-1-yl)-2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]ethanone (PubChem CID 29201094) has the molecular formula C21H22F2N4OS and a molecular weight of 416.50 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]ethanone.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 29201094 |
| Molecular Formula | C21H22F2N4OS |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-[2-(difluoromethylsulfanyl)benzimidazol-1-yl]ethanone |
| SMILES | O=C(Cn1c(SC(F)F)nc2ccccc21)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H22F2N4OS/c22-20(23)29-21-24-17-8-4-5-9-18(17)27(21)15-19(28)26-12-10-25(11-13-26)14-16-6-2-1-3-7-16/h1-9,20H,10-15H2 |
| InChIKey | XHPLEOOTASPORR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |