C16H18N2O8 — CID 2922774
N-(furan-2-ylmethyl)-3-(4-nitrophenoxy)propan-1-amine;oxalic acid (PubChem CID 2922774) has the molecular formula C16H18N2O8 and a molecular weight of 366.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-(4-nitrophenoxy)propan-1-amine;oxalic acid.
| Compound Name | N-(furan-2-ylmethyl)-3-(4-nitrophenoxy)propan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2922774 |
| Molecular Formula | C16H18N2O8 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-(4-nitrophenoxy)propan-1-amine;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=[N+]([O-])c1ccc(OCCCNCc2ccco2)cc1 |
| InChI | InChI=1S/C14H16N2O4.C2H2O4/c17-16(18)12-4-6-13(7-5-12)19-10-2-8-15-11-14-3-1-9-20-14;3-1(4)2(5)6/h1,3-7,9,15H,2,8,10-11H2;(H,3,4)(H,5,6) |
| InChIKey | NAVLJGBWTJONNP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|