C19H23NO8 — CID 2923338
ethyl 4-[3-(furan-2-ylmethylamino)propoxy]benzoate;oxalic acid (PubChem CID 2923338) has the molecular formula C19H23NO8 and a molecular weight of 393.39 g/mol. Its IUPAC name is ethyl 4-[3-(furan-2-ylmethylamino)propoxy]benzoate;oxalic acid.
| Compound Name | ethyl 4-[3-(furan-2-ylmethylamino)propoxy]benzoate;oxalic acid |
|---|---|
| PubChem CID | 2923338 |
| Molecular Formula | C19H23NO8 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | ethyl 4-[3-(furan-2-ylmethylamino)propoxy]benzoate;oxalic acid |
| SMILES | CCOC(=O)c1ccc(OCCCNCc2ccco2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H21NO4.C2H2O4/c1-2-20-17(19)14-6-8-15(9-7-14)21-12-4-10-18-13-16-5-3-11-22-16;3-1(4)2(5)6/h3,5-9,11,18H,2,4,10,12-13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JLESSLQVBKMBEB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|