C16H13N5O6 — CID 29260150
3,6-dimethyl-N'-(3-nitrobenzoyl)-4-oxofuro[2,3-d]pyrimidine-5-carbohydrazide (PubChem CID 29260150) has the molecular formula C16H13N5O6 and a molecular weight of 371.31 g/mol. Its IUPAC name is 3,6-dimethyl-N'-(3-nitrobenzoyl)-4-oxofuro[2,3-d]pyrimidine-5-carbohydrazide.
| Compound Name | 3,6-dimethyl-N'-(3-nitrobenzoyl)-4-oxofuro[2,3-d]pyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 29260150 |
| Molecular Formula | C16H13N5O6 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 3,6-dimethyl-N'-(3-nitrobenzoyl)-4-oxofuro[2,3-d]pyrimidine-5-carbohydrazide |
| SMILES | Cc1oc2ncn(C)c(=O)c2c1C(=O)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13N5O6/c1-8-11(12-15(27-8)17-7-20(2)16(12)24)14(23)19-18-13(22)9-4-3-5-10(6-9)21(25)26/h3-7H,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | DCJYXRPICBLUJJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 149.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|