C12H15N3O3S2 — CID 2942478
4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-2,6-dimethylmorpholine (PubChem CID 2942478) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-2,6-dimethylmorpholine.
| Compound Name | 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 2942478 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2cccc3nsnc23)CC(C)O1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-8-6-15(7-9(2)18-8)20(16,17)11-5-3-4-10-12(11)14-19-13-10/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | BFRAVWQAGOKNOF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |