C25H24N2O5 — CID 29432740
5-(5-methoxy-2-phenylmethoxybenzoyl)-1-(3-methoxypropyl)-2-oxopyridine-3-carbonitrile (PubChem CID 29432740) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 5-(5-methoxy-2-phenylmethoxybenzoyl)-1-(3-methoxypropyl)-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-(5-methoxy-2-phenylmethoxybenzoyl)-1-(3-methoxypropyl)-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 29432740 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 5-(5-methoxy-2-phenylmethoxybenzoyl)-1-(3-methoxypropyl)-2-oxopyridine-3-carbonitrile |
| SMILES | COCCCn1cc(C(=O)c2cc(OC)ccc2OCc2ccccc2)cc(C#N)c1=O |
| InChI | InChI=1S/C25H24N2O5/c1-30-12-6-11-27-16-20(13-19(15-26)25(27)29)24(28)22-14-21(31-2)9-10-23(22)32-17-18-7-4-3-5-8-18/h3-5,7-10,13-14,16H,6,11-12,17H2,1-2H3 |
| InChIKey | DDFYWRAMUYNJGA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|