C23H21N3O5S2 — CID 29438261
[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate (PubChem CID 29438261) has the molecular formula C23H21N3O5S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate |
|---|---|
| PubChem CID | 29438261 |
| Molecular Formula | C23H21N3O5S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate |
| SMILES | COc1ccc(-c2nc(COC(=O)c3sc4nc5n(c(=O)c4c3C)CCC5)cs2)cc1OC |
| InChI | InChI=1S/C23H21N3O5S2/c1-12-18-21(25-17-5-4-8-26(17)22(18)27)33-19(12)23(28)31-10-14-11-32-20(24-14)13-6-7-15(29-2)16(9-13)30-3/h6-7,9,11H,4-5,8,10H2,1-3H3 |
| InChIKey | YTPBMCJPTNRITQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |