C20H23NO4 — CID 2945987
3,3,5,5-tetramethyl-6-(1-propanoylindol-3-yl)oxane-2,4-dione (PubChem CID 2945987) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-6-(1-propanoylindol-3-yl)oxane-2,4-dione.
| Compound Name | 3,3,5,5-tetramethyl-6-(1-propanoylindol-3-yl)oxane-2,4-dione |
|---|---|
| PubChem CID | 2945987 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3,3,5,5-tetramethyl-6-(1-propanoylindol-3-yl)oxane-2,4-dione |
| SMILES | CCC(=O)n1cc(C2OC(=O)C(C)(C)C(=O)C2(C)C)c2ccccc21 |
| InChI | InChI=1S/C20H23NO4/c1-6-15(22)21-11-13(12-9-7-8-10-14(12)21)16-19(2,3)17(23)20(4,5)18(24)25-16/h7-11,16H,6H2,1-5H3 |
| InChIKey | YRGLGBMNYVGQIA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|