C21H25NO4 — CID 3433166
6-(1-acetylindol-3-yl)-5,5-diethyl-3,3-dimethyloxane-2,4-dione (PubChem CID 3433166) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 6-(1-acetylindol-3-yl)-5,5-diethyl-3,3-dimethyloxane-2,4-dione.
| Compound Name | 6-(1-acetylindol-3-yl)-5,5-diethyl-3,3-dimethyloxane-2,4-dione |
|---|---|
| PubChem CID | 3433166 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 6-(1-acetylindol-3-yl)-5,5-diethyl-3,3-dimethyloxane-2,4-dione |
| SMILES | CCC1(CC)C(=O)C(C)(C)C(=O)OC1c1cn(C(C)=O)c2ccccc12 |
| InChI | InChI=1S/C21H25NO4/c1-6-21(7-2)17(26-19(25)20(4,5)18(21)24)15-12-22(13(3)23)16-11-9-8-10-14(15)16/h8-12,17H,6-7H2,1-5H3 |
| InChIKey | KLLSZIMKPHEVNM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|