C20H23NO3 — CID 44521789
1-[3-[(1R,2S,5R)-5-(hydroxymethyl)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]indol-1-yl]ethanone (PubChem CID 44521789) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-[3-[(1R,2S,5R)-5-(hydroxymethyl)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]indol-1-yl]ethanone.
| Compound Name | 1-[3-[(1R,2S,5R)-5-(hydroxymethyl)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]indol-1-yl]ethanone |
|---|---|
| PubChem CID | 44521789 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 1-[3-[(1R,2S,5R)-5-(hydroxymethyl)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]indol-1-yl]ethanone |
| SMILES | CC(=O)n1cc([C@H]2OC[C@]3(CO)CC=C(C)[C@H]2C3)c2ccccc21 |
| InChI | InChI=1S/C20H23NO3/c1-13-7-8-20(11-22)9-16(13)19(24-12-20)17-10-21(14(2)23)18-6-4-3-5-15(17)18/h3-7,10,16,19,22H,8-9,11-12H2,1-2H3/t16-,19+,20-/m1/s1 |
| InChIKey | XHTIJZPFYODHFZ-LSTHTHJFSA-N |
| XLogP | 3.71 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|