C22H21F2N3O5S — CID 29495929
3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 29495929) has the molecular formula C22H21F2N3O5S and a molecular weight of 477.49 g/mol. Its IUPAC name is 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 29495929 |
| Molecular Formula | C22H21F2N3O5S |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CCc1ncc(-c2ccc(F)cc2F)o1)Nc1cc(S(=O)(=O)N2CCCC2)ccc1O |
| InChI | InChI=1S/C22H21F2N3O5S/c23-14-3-5-16(17(24)11-14)20-13-25-22(32-20)8-7-21(29)26-18-12-15(4-6-19(18)28)33(30,31)27-9-1-2-10-27/h3-6,11-13,28H,1-2,7-10H2,(H,26,29) |
| InChIKey | GOVNBMJHYFPWFV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|