C21H23F2N3O5S — CID 24596743
2,4-difluoro-N-[4-(2-hydroxy-5-pyrrolidin-1-ylsulfonylanilino)-4-oxobutyl]benzamide (PubChem CID 24596743) has the molecular formula C21H23F2N3O5S and a molecular weight of 467.49 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-(2-hydroxy-5-pyrrolidin-1-ylsulfonylanilino)-4-oxobutyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-(2-hydroxy-5-pyrrolidin-1-ylsulfonylanilino)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 24596743 |
| Molecular Formula | C21H23F2N3O5S |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 2,4-difluoro-N-[4-(2-hydroxy-5-pyrrolidin-1-ylsulfonylanilino)-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)Nc1cc(S(=O)(=O)N2CCCC2)ccc1O |
| InChI | InChI=1S/C21H23F2N3O5S/c22-14-5-7-16(17(23)12-14)21(29)24-9-3-4-20(28)25-18-13-15(6-8-19(18)27)32(30,31)26-10-1-2-11-26/h5-8,12-13,27H,1-4,9-11H2,(H,24,29)(H,25,28) |
| InChIKey | JZLPIJLLKGXCMF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|