C21H22F2N4O5S — CID 30485549
2,4-difluoro-N-[3-oxo-3-[2-(4-pyrrolidin-1-ylsulfonylbenzoyl)hydrazinyl]propyl]benzamide (PubChem CID 30485549) has the molecular formula C21H22F2N4O5S and a molecular weight of 480.49 g/mol. Its IUPAC name is 2,4-difluoro-N-[3-oxo-3-[2-(4-pyrrolidin-1-ylsulfonylbenzoyl)hydrazinyl]propyl]benzamide.
| Compound Name | 2,4-difluoro-N-[3-oxo-3-[2-(4-pyrrolidin-1-ylsulfonylbenzoyl)hydrazinyl]propyl]benzamide |
|---|---|
| PubChem CID | 30485549 |
| Molecular Formula | C21H22F2N4O5S |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 2,4-difluoro-N-[3-oxo-3-[2-(4-pyrrolidin-1-ylsulfonylbenzoyl)hydrazinyl]propyl]benzamide |
| SMILES | O=C(CCNC(=O)c1ccc(F)cc1F)NNC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H22F2N4O5S/c22-15-5-8-17(18(23)13-15)21(30)24-10-9-19(28)25-26-20(29)14-3-6-16(7-4-14)33(31,32)27-11-1-2-12-27/h3-8,13H,1-2,9-12H2,(H,24,30)(H,25,28)(H,26,29) |
| InChIKey | PKDMDODAJFXLEJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|