C22H22ClN3O5S — CID 29495927
3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 29495927) has the molecular formula C22H22ClN3O5S and a molecular weight of 475.95 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 29495927 |
| Molecular Formula | C22H22ClN3O5S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CCc1ncc(-c2ccc(Cl)cc2)o1)Nc1cc(S(=O)(=O)N2CCCC2)ccc1O |
| InChI | InChI=1S/C22H22ClN3O5S/c23-16-5-3-15(4-6-16)20-14-24-22(31-20)10-9-21(28)25-18-13-17(7-8-19(18)27)32(29,30)26-11-1-2-12-26/h3-8,13-14,27H,1-2,9-12H2,(H,25,28) |
| InChIKey | SVUJGNODUKSUIV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|