C21H19N3O6S — CID 2955514
1-[2-(1,3-benzodioxol-5-yloxy)propanoylamino]-3-(4-methyl-2-oxochromen-7-yl)thiourea (PubChem CID 2955514) has the molecular formula C21H19N3O6S and a molecular weight of 441.47 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)propanoylamino]-3-(4-methyl-2-oxochromen-7-yl)thiourea.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)propanoylamino]-3-(4-methyl-2-oxochromen-7-yl)thiourea |
|---|---|
| PubChem CID | 2955514 |
| Molecular Formula | C21H19N3O6S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)propanoylamino]-3-(4-methyl-2-oxochromen-7-yl)thiourea |
| SMILES | Cc1cc(=O)oc2cc(NC(=S)NNC(=O)C(C)Oc3ccc4c(c3)OCO4)ccc12 |
| InChI | InChI=1S/C21H19N3O6S/c1-11-7-19(25)30-17-8-13(3-5-15(11)17)22-21(31)24-23-20(26)12(2)29-14-4-6-16-18(9-14)28-10-27-16/h3-9,12H,10H2,1-2H3,(H,23,26)(H2,22,24,31) |
| InChIKey | AYTBXCROSWSTGX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|