C23H34N2O2S — CID 2955544
1-[1-(1-adamantyl)butyl]-3-(2,4-dimethoxyphenyl)thiourea (PubChem CID 2955544) has the molecular formula C23H34N2O2S and a molecular weight of 402.60 g/mol. Its IUPAC name is 1-[1-(1-adamantyl)butyl]-3-(2,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[1-(1-adamantyl)butyl]-3-(2,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2955544 |
| Molecular Formula | C23H34N2O2S |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1-[1-(1-adamantyl)butyl]-3-(2,4-dimethoxyphenyl)thiourea |
| SMILES | CCCC(NC(=S)Nc1ccc(OC)cc1OC)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H34N2O2S/c1-4-5-21(23-12-15-8-16(13-23)10-17(9-15)14-23)25-22(28)24-19-7-6-18(26-2)11-20(19)27-3/h6-7,11,15-17,21H,4-5,8-10,12-14H2,1-3H3,(H2,24,25,28) |
| InChIKey | UPSGMDQALGWRTK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|