C27H20F3N3O5 — CID 2959712
3-[4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carbonyl]phenyl]chromen-2-one (PubChem CID 2959712) has the molecular formula C27H20F3N3O5 and a molecular weight of 523.47 g/mol. Its IUPAC name is 3-[4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carbonyl]phenyl]chromen-2-one.
| Compound Name | 3-[4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carbonyl]phenyl]chromen-2-one |
|---|---|
| PubChem CID | 2959712 |
| Molecular Formula | C27H20F3N3O5 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 3-[4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine-1-carbonyl]phenyl]chromen-2-one |
| SMILES | O=C(c1ccc(-c2cc3ccccc3oc2=O)cc1)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C27H20F3N3O5/c28-27(29,30)20-9-10-22(23(16-20)33(36)37)31-11-13-32(14-12-31)25(34)18-7-5-17(6-8-18)21-15-19-3-1-2-4-24(19)38-26(21)35/h1-10,15-16H,11-14H2 |
| InChIKey | OUULABIFPVWLJS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 96.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|