C24H35ClN4OS — CID 2959958
2-(1-adamantyl)-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]acetamide;hydrochloride (PubChem CID 2959958) has the molecular formula C24H35ClN4OS and a molecular weight of 463.09 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]acetamide;hydrochloride.
| Compound Name | 2-(1-adamantyl)-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 2959958 |
| Molecular Formula | C24H35ClN4OS |
| Molecular Weight | 463.09 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 2-(1-adamantyl)-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]acetamide;hydrochloride |
| SMILES | CN1CCN(c2ccc(NC(=S)NC(=O)CC34CC5CC(CC(C5)C3)C4)cc2)CC1.Cl |
| InChI | InChI=1S/C24H34N4OS.ClH/c1-27-6-8-28(9-7-27)21-4-2-20(3-5-21)25-23(30)26-22(29)16-24-13-17-10-18(14-24)12-19(11-17)15-24;/h2-5,17-19H,6-16H2,1H3,(H2,25,26,29,30);1H |
| InChIKey | NRBVINSMYHVUBX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.09 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|