C23H25ClN2O4S — CID 2983186
N-(2-chloro-4,6-dimethylphenyl)-3-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanamide (PubChem CID 2983186) has the molecular formula C23H25ClN2O4S and a molecular weight of 460.98 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-3-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-3-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 2983186 |
| Molecular Formula | C23H25ClN2O4S |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-3-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanamide |
| SMILES | CCOc1ccc(N2C(=O)CC(SCCC(=O)Nc3c(C)cc(C)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C23H25ClN2O4S/c1-4-30-17-7-5-16(6-8-17)26-21(28)13-19(23(26)29)31-10-9-20(27)25-22-15(3)11-14(2)12-18(22)24/h5-8,11-12,19H,4,9-10,13H2,1-3H3,(H,25,27) |
| InChIKey | OJWXSHLIWRYEKX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|