C23H23N3O2S — CID 2984604
N-(1,3-diethyl-2-oxobenzimidazol-5-yl)-2-naphthalen-2-ylsulfanylacetamide (PubChem CID 2984604) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-(1,3-diethyl-2-oxobenzimidazol-5-yl)-2-naphthalen-2-ylsulfanylacetamide.
| Compound Name | N-(1,3-diethyl-2-oxobenzimidazol-5-yl)-2-naphthalen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 2984604 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-(1,3-diethyl-2-oxobenzimidazol-5-yl)-2-naphthalen-2-ylsulfanylacetamide |
| SMILES | CCn1c(=O)n(CC)c2cc(NC(=O)CSc3ccc4ccccc4c3)ccc21 |
| InChI | InChI=1S/C23H23N3O2S/c1-3-25-20-12-10-18(14-21(20)26(4-2)23(25)28)24-22(27)15-29-19-11-9-16-7-5-6-8-17(16)13-19/h5-14H,3-4,15H2,1-2H3,(H,24,27) |
| InChIKey | NNYUFHQGQLKCBB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |