C19H14N2O4 — CID 2993069
4-methyl-7-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxy]chromen-2-one (PubChem CID 2993069) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is 4-methyl-7-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxy]chromen-2-one.
| Compound Name | 4-methyl-7-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 2993069 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-methyl-7-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCc3nnc(-c4ccccc4)o3)ccc12 |
| InChI | InChI=1S/C19H14N2O4/c1-12-9-18(22)24-16-10-14(7-8-15(12)16)23-11-17-20-21-19(25-17)13-5-3-2-4-6-13/h2-10H,11H2,1H3 |
| InChIKey | WBLFZMOTIGAQCV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|