About 3-hydroxyhex-4-ynal
3-hydroxyhex-4-ynal (PubChem CID 91461198) has the molecular formula C6H8O2
and a molecular weight of 112.13 g/mol. Its IUPAC name is 3-hydroxyhex-4-ynal.
Molecular Properties
| Compound Name | 3-hydroxyhex-4-ynal |
| PubChem CID | 91461198 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | 3-hydroxyhex-4-ynal |
| SMILES | CC#CC(O)CC=O |
| InChI | InChI=1S/C6H8O2/c1-2-3-6(8)4-5-7/h5-6,8H,4H2,1H3 |
| InChIKey | DFXJZXITHNBFDG-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyhex-4-ynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyhex-4-ynal?
The IUPAC name of 3-hydroxyhex-4-ynal (CID 91461198) is 3-hydroxyhex-4-ynal.
What is the SMILES notation for 3-hydroxyhex-4-ynal?
The canonical SMILES for 3-hydroxyhex-4-ynal is CC#CC(O)CC=O.
What is the InChIKey of 3-hydroxyhex-4-ynal?
The InChIKey is DFXJZXITHNBFDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2/c1-2-3-6(8)4-5-7/h5-6,8H,4H2,1H3.
What are the key properties of 3-hydroxyhex-4-ynal?
3-hydroxyhex-4-ynal has a molecular weight of 112.13 g/mol, XLogP of -0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyhex-4-ynal is sourced from PubChem (CID 91461198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).