About 3-nonyldodecanal
3-nonyldodecanal (PubChem CID 142613821) has the molecular formula C21H42O
and a molecular weight of 310.57 g/mol. Its IUPAC name is 3-nonyldodecanal.
Molecular Properties
| Compound Name | 3-nonyldodecanal |
| PubChem CID | 142613821 |
| Molecular Formula | C21H42O |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.32 |
| IUPAC Name | 3-nonyldodecanal |
| SMILES | CCCCCCCCCC(CC=O)CCCCCCCCC |
| InChI | InChI=1S/C21H42O/c1-3-5-7-9-11-13-15-17-21(19-20-22)18-16-14-12-10-8-6-4-2/h20-21H,3-19H2,1-2H3 |
| InChIKey | AISGMDQFZSOVHU-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-nonyldodecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nonyldodecanal?
The IUPAC name of 3-nonyldodecanal (CID 142613821) is 3-nonyldodecanal.
What is the SMILES notation for 3-nonyldodecanal?
The canonical SMILES for 3-nonyldodecanal is CCCCCCCCCC(CC=O)CCCCCCCCC.
What is the InChIKey of 3-nonyldodecanal?
The InChIKey is AISGMDQFZSOVHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O/c1-3-5-7-9-11-13-15-17-21(19-20-22)18-16-14-12-10-8-6-4-2/h20-21H,3-19H2,1-2H3.
What are the key properties of 3-nonyldodecanal?
3-nonyldodecanal has a molecular weight of 310.57 g/mol, XLogP of 7.47, 18 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nonyldodecanal is sourced from PubChem (CID 142613821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).