C16H17BrFN3O2S — CID 3001130
1-(5-bromo-2-pyridinyl)-3-[2-(6-fluoro-2,3-dimethoxyphenyl)ethyl]thiourea (PubChem CID 3001130) has the molecular formula C16H17BrFN3O2S and a molecular weight of 414.30 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-[2-(6-fluoro-2,3-dimethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-(5-bromo-2-pyridinyl)-3-[2-(6-fluoro-2,3-dimethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 3001130 |
| Molecular Formula | C16H17BrFN3O2S |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-[2-(6-fluoro-2,3-dimethoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc(F)c(CCNC(=S)Nc2ccc(Br)cn2)c1OC |
| InChI | InChI=1S/C16H17BrFN3O2S/c1-22-13-5-4-12(18)11(15(13)23-2)7-8-19-16(24)21-14-6-3-10(17)9-20-14/h3-6,9H,7-8H2,1-2H3,(H2,19,20,21,24) |
| InChIKey | BUKTZZDIPVJPGP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|