C15H14BrF2N3OS — CID 3001149
1-(5-bromo-2-pyridinyl)-3-[2-(2,6-difluoro-3-methoxyphenyl)ethyl]thiourea (PubChem CID 3001149) has the molecular formula C15H14BrF2N3OS and a molecular weight of 402.26 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-[2-(2,6-difluoro-3-methoxyphenyl)ethyl]thiourea.
| Compound Name | 1-(5-bromo-2-pyridinyl)-3-[2-(2,6-difluoro-3-methoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 3001149 |
| Molecular Formula | C15H14BrF2N3OS |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-[2-(2,6-difluoro-3-methoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc(F)c(CCNC(=S)Nc2ccc(Br)cn2)c1F |
| InChI | InChI=1S/C15H14BrF2N3OS/c1-22-12-4-3-11(17)10(14(12)18)6-7-19-15(23)21-13-5-2-9(16)8-20-13/h2-5,8H,6-7H2,1H3,(H2,19,20,21,23) |
| InChIKey | HINMFTUIHCBZCY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|