C16H14BrFN4OS — CID 3001156
1-(5-bromo-2-pyridinyl)-3-[2-(2-cyano-6-fluoro-3-methoxyphenyl)ethyl]thiourea (PubChem CID 3001156) has the molecular formula C16H14BrFN4OS and a molecular weight of 409.28 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-[2-(2-cyano-6-fluoro-3-methoxyphenyl)ethyl]thiourea.
| Compound Name | 1-(5-bromo-2-pyridinyl)-3-[2-(2-cyano-6-fluoro-3-methoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 3001156 |
| Molecular Formula | C16H14BrFN4OS |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-[2-(2-cyano-6-fluoro-3-methoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc(F)c(CCNC(=S)Nc2ccc(Br)cn2)c1C#N |
| InChI | InChI=1S/C16H14BrFN4OS/c1-23-14-4-3-13(18)11(12(14)8-19)6-7-20-16(24)22-15-5-2-10(17)9-21-15/h2-5,9H,6-7H2,1H3,(H2,20,21,22,24) |
| InChIKey | UMDZTWFRNJDGSH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|