C21H23N5S2 — CID 3001223
1-cyclohexyl-3-[4-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl]thiourea (PubChem CID 3001223) has the molecular formula C21H23N5S2 and a molecular weight of 409.58 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[4-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 3001223 |
| Molecular Formula | C21H23N5S2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 1-cyclohexyl-3-[4-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl]thiourea |
| SMILES | S=C(Nc1ccc(-c2n[nH]c(=S)n2-c2ccccc2)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C21H23N5S2/c27-20(22-16-7-3-1-4-8-16)23-17-13-11-15(12-14-17)19-24-25-21(28)26(19)18-9-5-2-6-10-18/h2,5-6,9-14,16H,1,3-4,7-8H2,(H,25,28)(H2,22,23,27) |
| InChIKey | CJFIWMGRTXFFOD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 57.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|