C13H15N3O2S2 — CID 3005282
3-(morpholin-4-ylmethyl)-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-4-one (PubChem CID 3005282) has the molecular formula C13H15N3O2S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is 3-(morpholin-4-ylmethyl)-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-4-one.
| Compound Name | 3-(morpholin-4-ylmethyl)-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-4-one |
|---|---|
| PubChem CID | 3005282 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 3-(morpholin-4-ylmethyl)-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-4-one |
| SMILES | O=C1C(=Cc2cccs2)NC(=S)N1CN1CCOCC1 |
| InChI | InChI=1S/C13H15N3O2S2/c17-12-11(8-10-2-1-7-20-10)14-13(19)16(12)9-15-3-5-18-6-4-15/h1-2,7-8H,3-6,9H2,(H,14,19) |
| InChIKey | IHKNAOKZLOKQDG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|