C13H19N3O2S2 — CID 3008029
2-(dimethylamino)ethyl N-[(2-methyl-5-nitrophenyl)methyl]carbamodithioate (PubChem CID 3008029) has the molecular formula C13H19N3O2S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-[(2-methyl-5-nitrophenyl)methyl]carbamodithioate.
| Compound Name | 2-(dimethylamino)ethyl N-[(2-methyl-5-nitrophenyl)methyl]carbamodithioate |
|---|---|
| PubChem CID | 3008029 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(dimethylamino)ethyl N-[(2-methyl-5-nitrophenyl)methyl]carbamodithioate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1CNC(=S)SCCN(C)C |
| InChI | InChI=1S/C13H19N3O2S2/c1-10-4-5-12(16(17)18)8-11(10)9-14-13(19)20-7-6-15(2)3/h4-5,8H,6-7,9H2,1-3H3,(H,14,19) |
| InChIKey | MZRMAXKWNDJXGV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|