C12H16N3O3S- — CID 8675667
2-[(butylcarbamothioylamino)methyl]-4-nitrophenolate (PubChem CID 8675667) has the molecular formula C12H16N3O3S- and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[(butylcarbamothioylamino)methyl]-4-nitrophenolate.
| Compound Name | 2-[(butylcarbamothioylamino)methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 8675667 |
| Molecular Formula | C12H16N3O3S- |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-[(butylcarbamothioylamino)methyl]-4-nitrophenolate |
| SMILES | CCCCNC(=S)NCc1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C12H17N3O3S/c1-2-3-6-13-12(19)14-8-9-7-10(15(17)18)4-5-11(9)16/h4-5,7,16H,2-3,6,8H2,1H3,(H2,13,14,19)/p-1 |
| InChIKey | RLYYHMTWRBARJZ-UHFFFAOYSA-M |
| XLogP | 1.43 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|