C16H16N3O3S- — CID 8628603
2-[[(2,3-dimethylphenyl)carbamothioylamino]methyl]-4-nitrophenolate (PubChem CID 8628603) has the molecular formula C16H16N3O3S- and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[[(2,3-dimethylphenyl)carbamothioylamino]methyl]-4-nitrophenolate.
| Compound Name | 2-[[(2,3-dimethylphenyl)carbamothioylamino]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 8628603 |
| Molecular Formula | C16H16N3O3S- |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-[[(2,3-dimethylphenyl)carbamothioylamino]methyl]-4-nitrophenolate |
| SMILES | Cc1cccc(NC(=S)NCc2cc([N+](=O)[O-])ccc2[O-])c1C |
| InChI | InChI=1S/C16H17N3O3S/c1-10-4-3-5-14(11(10)2)18-16(23)17-9-12-8-13(19(21)22)6-7-15(12)20/h3-8,20H,9H2,1-2H3,(H2,17,18,23)/p-1 |
| InChIKey | AQGKWAOCYFUQFG-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|