C45H51N3O5 — CID 3010367
N-[(2S)-1-[[(2S,3S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]naphthalene-2-carboxamide (PubChem CID 3010367) has the molecular formula C45H51N3O5 and a molecular weight of 713.92 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S,3S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-[(2S)-1-[[(2S,3S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3010367 |
| Molecular Formula | C45H51N3O5 |
| Molecular Weight | 713.92 g/mol |
| Exact Mass | 713.38 |
| IUPAC Name | N-[(2S)-1-[[(2S,3S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]naphthalene-2-carboxamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)C[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C45H51N3O5/c1-30(2)24-40(48-44(51)37-23-22-35-20-11-12-21-36(35)27-37)45(52)47-39(26-34-18-9-6-10-19-34)41(49)28-38(25-33-16-7-5-8-17-33)46-42(50)29-53-43-31(3)14-13-15-32(43)4/h5-23,27,30,38-41,49H,24-26,28-29H2,1-4H3,(H,46,50)(H,47,52)(H,48,51)/t38-,39-,40-,41-/m0/s1 |
| InChIKey | TUATUSNALBCKTF-MFDNGWNGSA-N |
| XLogP | 6.89 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.92 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |