C36H46N4O4S — CID 3010244
(2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-sulfanylideneimidazolidin-1-yl)butanamide (PubChem CID 3010244) has the molecular formula C36H46N4O4S and a molecular weight of 630.86 g/mol. Its IUPAC name is (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-sulfanylideneimidazolidin-1-yl)butanamide.
| Compound Name | (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-sulfanylideneimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 3010244 |
| Molecular Formula | C36H46N4O4S |
| Molecular Weight | 630.86 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-sulfanylideneimidazolidin-1-yl)butanamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)[C@H](C(C)C)N1CCNC1=S |
| InChI | InChI=1S/C36H46N4O4S/c1-24(2)33(40-19-18-37-36(40)45)35(43)38-29(20-27-14-7-5-8-15-27)22-31(41)30(21-28-16-9-6-10-17-28)39-32(42)23-44-34-25(3)12-11-13-26(34)4/h5-17,24,29-31,33,41H,18-23H2,1-4H3,(H,37,45)(H,38,43)(H,39,42)/t29-,30-,31-,33-/m0/s1 |
| InChIKey | NWKVZEZWWQOQBP-QUUJSONZSA-N |
| XLogP | 4.10 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|