C37H48N4O5 — CID 66765792
N-[(2S,4S,5S)-5-[amino(phenyl)methyl]-7-(2,6-dimethylphenoxy)-4-hydroxy-6-oxo-1-phenylheptan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide (PubChem CID 66765792) has the molecular formula C37H48N4O5 and a molecular weight of 628.81 g/mol. Its IUPAC name is N-[(2S,4S,5S)-5-[amino(phenyl)methyl]-7-(2,6-dimethylphenoxy)-4-hydroxy-6-oxo-1-phenylheptan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide.
| Compound Name | N-[(2S,4S,5S)-5-[amino(phenyl)methyl]-7-(2,6-dimethylphenoxy)-4-hydroxy-6-oxo-1-phenylheptan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide |
|---|---|
| PubChem CID | 66765792 |
| Molecular Formula | C37H48N4O5 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | N-[(2S,4S,5S)-5-[amino(phenyl)methyl]-7-(2,6-dimethylphenoxy)-4-hydroxy-6-oxo-1-phenylheptan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide |
| SMILES | Cc1cccc(C)c1OCC(=O)[C@@H](C(N)c1ccccc1)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)C(C(C)C)N1CCCNC1=O |
| InChI | InChI=1S/C37H48N4O5/c1-24(2)34(41-20-12-19-39-37(41)45)36(44)40-29(21-27-15-7-5-8-16-27)22-30(42)32(33(38)28-17-9-6-10-18-28)31(43)23-46-35-25(3)13-11-14-26(35)4/h5-11,13-18,24,29-30,32-34,42H,12,19-23,38H2,1-4H3,(H,39,45)(H,40,44)/t29-,30-,32-,33?,34?/m0/s1 |
| InChIKey | SYOKXHJSNOCBTO-XINOPNRNSA-N |
| XLogP | 4.49 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |