C37H55N3O5 — CID 5493699
2-(2,6-dimethylphenoxy)-N-[(2S,3S,5S,8S)-5-(2-ethylbutyl)-3-hydroxy-9-methyl-7-oxo-8-(2-oxo-1,3-diazinan-1-yl)-1-phenyldecan-2-yl]acetamide (PubChem CID 5493699) has the molecular formula C37H55N3O5 and a molecular weight of 621.86 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)-N-[(2S,3S,5S,8S)-5-(2-ethylbutyl)-3-hydroxy-9-methyl-7-oxo-8-(2-oxo-1,3-diazinan-1-yl)-1-phenyldecan-2-yl]acetamide.
| Compound Name | 2-(2,6-dimethylphenoxy)-N-[(2S,3S,5S,8S)-5-(2-ethylbutyl)-3-hydroxy-9-methyl-7-oxo-8-(2-oxo-1,3-diazinan-1-yl)-1-phenyldecan-2-yl]acetamide |
|---|---|
| PubChem CID | 5493699 |
| Molecular Formula | C37H55N3O5 |
| Molecular Weight | 621.86 g/mol |
| Exact Mass | 621.41 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)-N-[(2S,3S,5S,8S)-5-(2-ethylbutyl)-3-hydroxy-9-methyl-7-oxo-8-(2-oxo-1,3-diazinan-1-yl)-1-phenyldecan-2-yl]acetamide |
| SMILES | CCC(CC)C[C@H](CC(=O)[C@H](C(C)C)N1CCCNC1=O)C[C@H](O)[C@H](Cc1ccccc1)NC(=O)COc1c(C)cccc1C |
| InChI | InChI=1S/C37H55N3O5/c1-7-28(8-2)20-30(23-33(42)35(25(3)4)40-19-13-18-38-37(40)44)22-32(41)31(21-29-16-10-9-11-17-29)39-34(43)24-45-36-26(5)14-12-15-27(36)6/h9-12,14-17,25,28,30-32,35,41H,7-8,13,18-24H2,1-6H3,(H,38,44)(H,39,43)/t30-,31-,32-,35-/m0/s1 |
| InChIKey | ZCNCMPNGGBVRLS-ABVVNCBOSA-N |
| XLogP | 6.00 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.86 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |