C37H48N4O7 — CID 101161866
(2R)-N-[(2R,4R,5R)-5-[[2-(3,5-dimethoxyphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide (PubChem CID 101161866) has the molecular formula C37H48N4O7 and a molecular weight of 660.81 g/mol. Its IUPAC name is (2R)-N-[(2R,4R,5R)-5-[[2-(3,5-dimethoxyphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide.
| Compound Name | (2R)-N-[(2R,4R,5R)-5-[[2-(3,5-dimethoxyphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide |
|---|---|
| PubChem CID | 101161866 |
| Molecular Formula | C37H48N4O7 |
| Molecular Weight | 660.81 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | (2R)-N-[(2R,4R,5R)-5-[[2-(3,5-dimethoxyphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide |
| SMILES | COc1cc(OC)cc(OCC(=O)N[C@H](Cc2ccccc2)[C@H](O)C[C@@H](Cc2ccccc2)NC(=O)[C@@H](C(C)C)N2CCCNC2=O)c1 |
| InChI | InChI=1S/C37H48N4O7/c1-25(2)35(41-17-11-16-38-37(41)45)36(44)39-28(18-26-12-7-5-8-13-26)20-33(42)32(19-27-14-9-6-10-15-27)40-34(43)24-48-31-22-29(46-3)21-30(23-31)47-4/h5-10,12-15,21-23,25,28,32-33,35,42H,11,16-20,24H2,1-4H3,(H,38,45)(H,39,44)(H,40,43)/t28-,32-,33-,35-/m1/s1 |
| InChIKey | LOOVADDUFTWQJQ-CEEZKUQMSA-N |
| XLogP | 3.73 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.81 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |