C37H46N4O6 — CID 3010249
(2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-2-(2,3-dioxopiperazin-1-yl)-3-methylbutanamide (PubChem CID 3010249) has the molecular formula C37H46N4O6 and a molecular weight of 642.80 g/mol. Its IUPAC name is (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-2-(2,3-dioxopiperazin-1-yl)-3-methylbutanamide.
| Compound Name | (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-2-(2,3-dioxopiperazin-1-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 3010249 |
| Molecular Formula | C37H46N4O6 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-2-(2,3-dioxopiperazin-1-yl)-3-methylbutanamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)[C@H](C(C)C)N1CCNC(=O)C1=O |
| InChI | InChI=1S/C37H46N4O6/c1-24(2)33(41-19-18-38-36(45)37(41)46)35(44)39-29(20-27-14-7-5-8-15-27)22-31(42)30(21-28-16-9-6-10-17-28)40-32(43)23-47-34-25(3)12-11-13-26(34)4/h5-17,24,29-31,33,42H,18-23H2,1-4H3,(H,38,45)(H,39,44)(H,40,43)/t29-,30-,31-,33-/m0/s1 |
| InChIKey | ZCRLFINHXYZBOC-QUUJSONZSA-N |
| XLogP | 2.87 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|