C37H47N3O5 — CID 3010248
(2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide (PubChem CID 3010248) has the molecular formula C37H47N3O5 and a molecular weight of 613.80 g/mol. Its IUPAC name is (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide.
| Compound Name | (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 3010248 |
| Molecular Formula | C37H47N3O5 |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 613.35 |
| IUPAC Name | (2S)-N-[(2S,4S,5S)-5-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-2-(2-oxopyrrolidin-1-yl)butanamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)[C@H](C(C)C)N1CCCC1=O |
| InChI | InChI=1S/C37H47N3O5/c1-25(2)35(40-20-12-19-34(40)43)37(44)38-30(21-28-15-7-5-8-16-28)23-32(41)31(22-29-17-9-6-10-18-29)39-33(42)24-45-36-26(3)13-11-14-27(36)4/h5-11,13-18,25,30-32,35,41H,12,19-24H2,1-4H3,(H,38,44)(H,39,42)/t30-,31-,32-,35-/m0/s1 |
| InChIKey | FACQQHVGJSQKBL-ABVVNCBOSA-N |
| XLogP | 4.54 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |