C39H51CaN4O9P — CID 11657863
calcium 1-[(2S,5S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-5-[[(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoyl]amino]-1,6-diphenylhexan-3-yl]oxyethyl phosphate (PubChem CID 11657863) has the molecular formula C39H51CaN4O9P and a molecular weight of 790.91 g/mol. Its IUPAC name is calcium 1-[(2S,5S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-5-[[(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoyl]amino]-1,6-diphenylhexan-3-yl]oxyethyl phosphate.
| Compound Name | calcium 1-[(2S,5S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-5-[[(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoyl]amino]-1,6-diphenylhexan-3-yl]oxyethyl phosphate |
|---|---|
| PubChem CID | 11657863 |
| Molecular Formula | C39H51CaN4O9P |
| Molecular Weight | 790.91 g/mol |
| Exact Mass | 790.30 |
| IUPAC Name | calcium 1-[(2S,5S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-5-[[(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoyl]amino]-1,6-diphenylhexan-3-yl]oxyethyl phosphate |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)C(C[C@H](Cc1ccccc1)NC(=O)[C@H](C(C)C)N1CCCNC1=O)OC(C)OP(=O)([O-])[O-].[Ca+2] |
| InChI | InChI=1S/C39H53N4O9P.Ca/c1-26(2)36(43-21-13-20-40-39(43)46)38(45)41-32(22-30-16-8-6-9-17-30)24-34(51-29(5)52-53(47,48)49)33(23-31-18-10-7-11-19-31)42-35(44)25-50-37-27(3)14-12-15-28(37)4;/h6-12,14-19,26,29,32-34,36H,13,20-25H2,1-5H3,(H,40,46)(H,41,45)(H,42,44)(H2,47,48,49);/q;+2/p-2/t29?,32-,33-,34?,36-;/m0./s1 |
| InChIKey | LWUWMICXTVOMHH-HJLKUYIISA-L |
| XLogP | 3.16 |
| TPSA | 181.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.91 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|