C39H50N6O7 — CID 143663909
[(2S,3S,5S)-5-[[(2S)-2-(3-carbamoyl-2-oxo-1,3-diazinan-1-yl)-3-methylbutanoyl]amino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-1,6-diphenylhexan-3-yl] carbamate (PubChem CID 143663909) has the molecular formula C39H50N6O7 and a molecular weight of 714.86 g/mol. Its IUPAC name is [(2S,3S,5S)-5-[[(2S)-2-(3-carbamoyl-2-oxo-1,3-diazinan-1-yl)-3-methylbutanoyl]amino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-1,6-diphenylhexan-3-yl] carbamate.
| Compound Name | [(2S,3S,5S)-5-[[(2S)-2-(3-carbamoyl-2-oxo-1,3-diazinan-1-yl)-3-methylbutanoyl]amino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-1,6-diphenylhexan-3-yl] carbamate |
|---|---|
| PubChem CID | 143663909 |
| Molecular Formula | C39H50N6O7 |
| Molecular Weight | 714.86 g/mol |
| Exact Mass | 714.37 |
| IUPAC Name | [(2S,3S,5S)-5-[[(2S)-2-(3-carbamoyl-2-oxo-1,3-diazinan-1-yl)-3-methylbutanoyl]amino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-1,6-diphenylhexan-3-yl] carbamate |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@H](C[C@H](Cc1ccccc1)NC(=O)[C@H](C(C)C)N1CCCN(C(N)=O)C1=O)OC(N)=O |
| InChI | InChI=1S/C39H50N6O7/c1-25(2)34(44-19-12-20-45(37(40)48)39(44)50)36(47)42-30(21-28-15-7-5-8-16-28)23-32(52-38(41)49)31(22-29-17-9-6-10-18-29)43-33(46)24-51-35-26(3)13-11-14-27(35)4/h5-11,13-18,25,30-32,34H,12,19-24H2,1-4H3,(H2,40,48)(H2,41,49)(H,42,47)(H,43,46)/t30-,31-,32-,34-/m0/s1 |
| InChIKey | VJHYLHBIBLDGHY-SUGCFTRWSA-N |
| XLogP | 4.22 |
| TPSA | 186.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.86 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |