C38H48FN3O5 — CID 159013026
2-(2,6-dimethylphenoxy)-N-[(2S,3S,5S,8S)-5-[(4-fluorophenyl)methyl]-3-hydroxy-9-methyl-7-oxo-8-(2-oxo-1,3-diazinan-1-yl)-1-phenyldecan-2-yl]acetamide (PubChem CID 159013026) has the molecular formula C38H48FN3O5 and a molecular weight of 645.82 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)-N-[(2S,3S,5S,8S)-5-[(4-fluorophenyl)methyl]-3-hydroxy-9-methyl-7-oxo-8-(2-oxo-1,3-diazinan-1-yl)-1-phenyldecan-2-yl]acetamide.
| Compound Name | 2-(2,6-dimethylphenoxy)-N-[(2S,3S,5S,8S)-5-[(4-fluorophenyl)methyl]-3-hydroxy-9-methyl-7-oxo-8-(2-oxo-1,3-diazinan-1-yl)-1-phenyldecan-2-yl]acetamide |
|---|---|
| PubChem CID | 159013026 |
| Molecular Formula | C38H48FN3O5 |
| Molecular Weight | 645.82 g/mol |
| Exact Mass | 645.36 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)-N-[(2S,3S,5S,8S)-5-[(4-fluorophenyl)methyl]-3-hydroxy-9-methyl-7-oxo-8-(2-oxo-1,3-diazinan-1-yl)-1-phenyldecan-2-yl]acetamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@@H](CC(=O)[C@H](C(C)C)N1CCCNC1=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C38H48FN3O5/c1-25(2)36(42-19-9-18-40-38(42)46)34(44)23-30(20-29-14-16-31(39)17-15-29)22-33(43)32(21-28-12-6-5-7-13-28)41-35(45)24-47-37-26(3)10-8-11-27(37)4/h5-8,10-17,25,30,32-33,36,43H,9,18-24H2,1-4H3,(H,40,46)(H,41,45)/t30-,32-,33-,36-/m0/s1 |
| InChIKey | AJBLOKATGCJDGF-QWIMVIAWSA-N |
| XLogP | 5.56 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.82 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |