C14H9BrNO3+ — CID 30116029
(4-bromophenyl)-(2-hydroxy-[1,3]oxazolo[3,2-a]pyridin-4-ium-3-yl)methanone (PubChem CID 30116029) has the molecular formula C14H9BrNO3+ and a molecular weight of 319.13 g/mol. Its IUPAC name is (4-bromophenyl)-(2-hydroxy-[1,3]oxazolo[3,2-a]pyridin-4-ium-3-yl)methanone.
| Compound Name | (4-bromophenyl)-(2-hydroxy-[1,3]oxazolo[3,2-a]pyridin-4-ium-3-yl)methanone |
|---|---|
| PubChem CID | 30116029 |
| Molecular Formula | C14H9BrNO3+ |
| Molecular Weight | 319.13 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | (4-bromophenyl)-(2-hydroxy-[1,3]oxazolo[3,2-a]pyridin-4-ium-3-yl)methanone |
| SMILES | O=C(c1ccc(Br)cc1)c1c(O)oc2cccc[n+]12 |
| InChI | InChI=1S/C14H8BrNO3/c15-10-6-4-9(5-7-10)13(17)12-14(18)19-11-3-1-2-8-16(11)12/h1-8H/p+1 |
| InChIKey | NQCOXVSZIBXZIP-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 54.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.13 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|