C9H6ClNO3 — CID 3256385
3-(2-chloroacetyl)-[1,3]oxazolo[3,2-a]pyridin-4-ium-2-olate (PubChem CID 3256385) has the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. Its IUPAC name is 3-(2-chloroacetyl)-[1,3]oxazolo[3,2-a]pyridin-4-ium-2-olate.
| Compound Name | 3-(2-chloroacetyl)-[1,3]oxazolo[3,2-a]pyridin-4-ium-2-olate |
|---|---|
| PubChem CID | 3256385 |
| Molecular Formula | C9H6ClNO3 |
| Molecular Weight | 211.60 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 3-(2-chloroacetyl)-[1,3]oxazolo[3,2-a]pyridin-4-ium-2-olate |
| SMILES | O=C(CCl)c1c([O-])oc2cccc[n+]12 |
| InChI | InChI=1S/C9H6ClNO3/c10-5-6(12)8-9(13)14-7-3-1-2-4-11(7)8/h1-4H,5H2 |
| InChIKey | KIAJNEBRQSZUQR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 57.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.60 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|