C14H8N2O5 — CID 30116271
3-(4-nitrobenzoyl)-[1,3]oxazolo[3,2-a]pyridin-4-ium-2-olate (PubChem CID 30116271) has the molecular formula C14H8N2O5 and a molecular weight of 284.23 g/mol. Its IUPAC name is 3-(4-nitrobenzoyl)-[1,3]oxazolo[3,2-a]pyridin-4-ium-2-olate.
| Compound Name | 3-(4-nitrobenzoyl)-[1,3]oxazolo[3,2-a]pyridin-4-ium-2-olate |
|---|---|
| PubChem CID | 30116271 |
| Molecular Formula | C14H8N2O5 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-(4-nitrobenzoyl)-[1,3]oxazolo[3,2-a]pyridin-4-ium-2-olate |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)c1c([O-])oc2cccc[n+]12 |
| InChI | InChI=1S/C14H8N2O5/c17-13(9-4-6-10(7-5-9)16(19)20)12-14(18)21-11-3-1-2-8-15(11)12/h1-8H |
| InChIKey | JEFCCXAODIOYEG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 100.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|