C14H9N2O5+ — CID 3160434
(2-hydroxy-[1,3]oxazolo[3,2-a]pyridin-4-ium-3-yl)-(3-nitrophenyl)methanone (PubChem CID 3160434) has the molecular formula C14H9N2O5+ and a molecular weight of 285.24 g/mol. Its IUPAC name is (2-hydroxy-[1,3]oxazolo[3,2-a]pyridin-4-ium-3-yl)-(3-nitrophenyl)methanone.
| Compound Name | (2-hydroxy-[1,3]oxazolo[3,2-a]pyridin-4-ium-3-yl)-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 3160434 |
| Molecular Formula | C14H9N2O5+ |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | (2-hydroxy-[1,3]oxazolo[3,2-a]pyridin-4-ium-3-yl)-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)c1c(O)oc2cccc[n+]12 |
| InChI | InChI=1S/C14H8N2O5/c17-13(9-4-3-5-10(8-9)16(19)20)12-14(18)21-11-6-1-2-7-15(11)12/h1-8H/p+1 |
| InChIKey | OPUFJRKWFPLLJA-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 97.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|