C20H24N4O4S — CID 30126689
N'-(pyridin-3-ylmethyl)-N-[2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]oxamide (PubChem CID 30126689) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is N'-(pyridin-3-ylmethyl)-N-[2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]oxamide.
| Compound Name | N'-(pyridin-3-ylmethyl)-N-[2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 30126689 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N'-(pyridin-3-ylmethyl)-N-[2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]oxamide |
| SMILES | O=C(NCCc1ccc(S(=O)(=O)N2CCCC2)cc1)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C20H24N4O4S/c25-19(20(26)23-15-17-4-3-10-21-14-17)22-11-9-16-5-7-18(8-6-16)29(27,28)24-12-1-2-13-24/h3-8,10,14H,1-2,9,11-13,15H2,(H,22,25)(H,23,26) |
| InChIKey | QOTANHMNJFELIE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|