About sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate
sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate (PubChem CID 3017318) has the molecular formula C19H40NaO6S+
and a molecular weight of 419.58 g/mol. Its IUPAC name is sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate.
Molecular Properties
| Compound Name | sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate |
| PubChem CID | 3017318 |
| Molecular Formula | C19H40NaO6S+ |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate |
| SMILES | CCCCC(CC)COCC(C)OS(=O)(=O)OOCC(CC)CCCC.[Na+] |
| InChI | InChI=1S/C19H40O6S.Na/c1-6-10-12-18(8-3)15-22-14-17(5)24-26(20,21)25-23-16-19(9-4)13-11-7-2;/h17-19H,6-16H2,1-5H3;/q;+1 |
| InChIKey | ZUYRNBWEWUDMDO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate?
The IUPAC name of sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate (CID 3017318) is sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate.
What is the SMILES notation for sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate?
The canonical SMILES for sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate is CCCCC(CC)COCC(C)OS(=O)(=O)OOCC(CC)CCCC.[Na+].
What is the InChIKey of sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate?
The InChIKey is ZUYRNBWEWUDMDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O6S.Na/c1-6-10-12-18(8-3)15-22-14-17(5)24-26(20,21)25-23-16-19(9-4)13-11-7-2;/h17-19H,6-16H2,1-5H3;/q;+1.
What are the key properties of sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate?
sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate has a molecular weight of 419.58 g/mol, XLogP of 2.04, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-ethylhexoxy 1-(2-ethylhexoxy)propan-2-yl sulfate is sourced from PubChem (CID 3017318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).