C20H31NO2S — CID 3025264
2-[di(propan-2-yl)amino]ethyl 2-cyclohex-2-en-1-yl-2-thiophen-2-ylacetate (PubChem CID 3025264) has the molecular formula C20H31NO2S and a molecular weight of 349.54 g/mol. Its IUPAC name is 2-[di(propan-2-yl)amino]ethyl 2-cyclohex-2-en-1-yl-2-thiophen-2-ylacetate.
| Compound Name | 2-[di(propan-2-yl)amino]ethyl 2-cyclohex-2-en-1-yl-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 3025264 |
| Molecular Formula | C20H31NO2S |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 2-[di(propan-2-yl)amino]ethyl 2-cyclohex-2-en-1-yl-2-thiophen-2-ylacetate |
| SMILES | CC(C)N(CCOC(=O)C(c1cccs1)C1C=CCCC1)C(C)C |
| InChI | InChI=1S/C20H31NO2S/c1-15(2)21(16(3)4)12-13-23-20(22)19(18-11-8-14-24-18)17-9-6-5-7-10-17/h6,8-9,11,14-17,19H,5,7,10,12-13H2,1-4H3 |
| InChIKey | QTMYUJVVJGBKNX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|