C13H19N5O2S — CID 3027348
1,3-bis[(dimethylamino)methyl]-5-nitrobenzimidazole-2-thione (PubChem CID 3027348) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 1,3-bis[(dimethylamino)methyl]-5-nitrobenzimidazole-2-thione.
| Compound Name | 1,3-bis[(dimethylamino)methyl]-5-nitrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 3027348 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1,3-bis[(dimethylamino)methyl]-5-nitrobenzimidazole-2-thione |
| SMILES | CN(C)Cn1c(=S)n(CN(C)C)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C13H19N5O2S/c1-14(2)8-16-11-6-5-10(18(19)20)7-12(11)17(13(16)21)9-15(3)4/h5-7H,8-9H2,1-4H3 |
| InChIKey | XFOSWCUOHYWLQS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|