About N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride
N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride (PubChem CID 3028070) has the molecular formula C13H28ClN2O3-
and a molecular weight of 295.83 g/mol. Its IUPAC name is N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride.
Molecular Properties
| Compound Name | N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride |
| PubChem CID | 3028070 |
| Molecular Formula | C13H28ClN2O3- |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride |
| SMILES | CC[NH+](CC)CCO.O=C([O-])NC1CCCCC1.[Cl-] |
| InChI | InChI=1S/C7H13NO2.C6H15NO.ClH/c9-7(10)8-6-4-2-1-3-5-6;1-3-7(4-2)5-6-8;/h6,8H,1-5H2,(H,9,10);8H,3-6H2,1-2H3;1H/p-1 |
| InChIKey | KKIVHMDIRMDXKU-UHFFFAOYSA-M |
| XLogP | -3.84 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride?
The IUPAC name of N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride (CID 3028070) is N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride.
What is the SMILES notation for N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride?
The canonical SMILES for N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride is CC[NH+](CC)CCO.O=C([O-])NC1CCCCC1.[Cl-].
What is the InChIKey of N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride?
The InChIKey is KKIVHMDIRMDXKU-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H13NO2.C6H15NO.ClH/c9-7(10)8-6-4-2-1-3-5-6;1-3-7(4-2)5-6-8;/h6,8H,1-5H2,(H,9,10);8H,3-6H2,1-2H3;1H/p-1.
What are the key properties of N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride?
N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride has a molecular weight of 295.83 g/mol, XLogP of -3.84, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylcarbamate;diethyl(2-hydroxyethyl)azanium;chloride is sourced from PubChem (CID 3028070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).